About tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate
tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate (PubChem CID 122714304) has the molecular formula C28H35N3O3
and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate |
| PubChem CID | 122714304 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC2=CC(C)(C)N(C(=O)c3ccccc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-27(2,3)34-26(33)30-17-15-29(16-18-30)20-22-19-28(4,5)31(24-14-10-9-13-23(22)24)25(32)21-11-7-6-8-12-21/h6-14,19H,15-18,20H2,1-5H3 |
| InChIKey | UPDDPJMHRLRGKS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate (CID 122714304) is tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(CC2=CC(C)(C)N(C(=O)c3ccccc3)c3ccccc32)CC1.
What is the InChIKey of tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate?
The InChIKey is UPDDPJMHRLRGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35N3O3/c1-27(2,3)34-26(33)30-17-15-29(16-18-30)20-22-19-28(4,5)31(24-14-10-9-13-23(22)24)25(32)21-11-7-6-8-12-21/h6-14,19H,15-18,20H2,1-5H3.
What are the key properties of tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate?
tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate has a molecular weight of 461.61 g/mol, XLogP of 5.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(1-benzoyl-2,2-dimethylquinolin-4-yl)methyl]piperazine-1-carboxylate is sourced from PubChem (CID 122714304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).