About bis(7-oxa-1-azaspiro[3.4]octane);oxalate
bis(7-oxa-1-azaspiro[3.4]octane);oxalate (PubChem CID 122714495) has the molecular formula C14H22N2O6-2
and a molecular weight of 314.34 g/mol. Its IUPAC name is bis(7-oxa-1-azaspiro[3.4]octane);oxalate.
Molecular Properties
| Compound Name | bis(7-oxa-1-azaspiro[3.4]octane);oxalate |
| PubChem CID | 122714495 |
| Molecular Formula | C14H22N2O6-2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | bis(7-oxa-1-azaspiro[3.4]octane);oxalate |
| SMILES | C1CC2(CCOC2)N1.C1CC2(CCOC2)N1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C6H11NO.C2H2O4/c2*1-3-7-6(1)2-4-8-5-6;3-1(4)2(5)6/h2*7H,1-5H2;(H,3,4)(H,5,6)/p-2 |
| InChIKey | UYHNJOQRRFVIHM-UHFFFAOYSA-L |
| XLogP | -3.24 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(7-oxa-1-azaspiro[3.4]octane);oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(7-oxa-1-azaspiro[3.4]octane);oxalate?
The IUPAC name of bis(7-oxa-1-azaspiro[3.4]octane);oxalate (CID 122714495) is bis(7-oxa-1-azaspiro[3.4]octane);oxalate.
What is the SMILES notation for bis(7-oxa-1-azaspiro[3.4]octane);oxalate?
The canonical SMILES for bis(7-oxa-1-azaspiro[3.4]octane);oxalate is C1CC2(CCOC2)N1.C1CC2(CCOC2)N1.O=C([O-])C(=O)[O-].
What is the InChIKey of bis(7-oxa-1-azaspiro[3.4]octane);oxalate?
The InChIKey is UYHNJOQRRFVIHM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H11NO.C2H2O4/c2*1-3-7-6(1)2-4-8-5-6;3-1(4)2(5)6/h2*7H,1-5H2;(H,3,4)(H,5,6)/p-2.
What are the key properties of bis(7-oxa-1-azaspiro[3.4]octane);oxalate?
bis(7-oxa-1-azaspiro[3.4]octane);oxalate has a molecular weight of 314.34 g/mol, XLogP of -3.24, 0 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(7-oxa-1-azaspiro[3.4]octane);oxalate is sourced from PubChem (CID 122714495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).