C19H15N3OS — CID 1229080
5-(indol-3-ylidenemethyl)-3-methyl-2-phenylimino-1,3-thiazol-4-ol (PubChem CID 1229080) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 5-(indol-3-ylidenemethyl)-3-methyl-2-phenylimino-1,3-thiazol-4-ol.
| Compound Name | 5-(indol-3-ylidenemethyl)-3-methyl-2-phenylimino-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 1229080 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-(indol-3-ylidenemethyl)-3-methyl-2-phenylimino-1,3-thiazol-4-ol |
| SMILES | Cn1c(O)c(C=C2C=Nc3ccccc32)s/c1=N/c1ccccc1 |
| InChI | InChI=1S/C19H15N3OS/c1-22-18(23)17(24-19(22)21-14-7-3-2-4-8-14)11-13-12-20-16-10-6-5-9-15(13)16/h2-12,23H,1H3/b13-11?,21-19+ |
| InChIKey | GEPPSNIOWSRTNG-QKUJQWQYSA-N |
| XLogP | 4.28 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |