C23H21N3OS — CID 135648196
3-cyclopentyl-5-[(E)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol (PubChem CID 135648196) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-cyclopentyl-5-[(E)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol.
| Compound Name | 3-cyclopentyl-5-[(E)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 135648196 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-cyclopentyl-5-[(E)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol |
| SMILES | Oc1c(/C=C2/C=Nc3ccccc32)s/c(=N\c2ccccc2)n1C1CCCC1 |
| InChI | InChI=1S/C23H21N3OS/c27-22-21(14-16-15-24-20-13-7-6-12-19(16)20)28-23(25-17-8-2-1-3-9-17)26(22)18-10-4-5-11-18/h1-3,6-9,12-15,18,27H,4-5,10-11H2/b16-14-,25-23- |
| InChIKey | OIYUEDDBJKAYGA-WQXUAUFSSA-N |
| XLogP | 5.86 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |