C20H17N3OS — CID 135467632
3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol (PubChem CID 135467632) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol.
| Compound Name | 3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 135467632 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-2-phenylimino-1,3-thiazol-4-ol |
| SMILES | CCn1c(O)c(/C=C2\C=Nc3ccccc32)s/c1=N/c1ccccc1 |
| InChI | InChI=1S/C20H17N3OS/c1-2-23-19(24)18(25-20(23)22-15-8-4-3-5-9-15)12-14-13-21-17-11-7-6-10-16(14)17/h3-13,24H,2H2,1H3/b14-12+,22-20+ |
| InChIKey | XCBIDCWIGQALRB-FOAAXXMKSA-N |
| XLogP | 4.76 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |