About 5-benzyl-N-methyl-1,3-thiazol-2-amine
5-benzyl-N-methyl-1,3-thiazol-2-amine (PubChem CID 1229694) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 5-benzyl-N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-benzyl-N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 1229694 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-benzyl-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C11H12N2S/c1-12-11-13-8-10(14-11)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13) |
| InChIKey | HWFWJQTZQIUYJT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-N-methyl-1,3-thiazol-2-amine?
The IUPAC name of 5-benzyl-N-methyl-1,3-thiazol-2-amine (CID 1229694) is 5-benzyl-N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-benzyl-N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-benzyl-N-methyl-1,3-thiazol-2-amine is CNc1ncc(Cc2ccccc2)s1.
What is the InChIKey of 5-benzyl-N-methyl-1,3-thiazol-2-amine?
The InChIKey is HWFWJQTZQIUYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-12-11-13-8-10(14-11)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13).
What are the key properties of 5-benzyl-N-methyl-1,3-thiazol-2-amine?
5-benzyl-N-methyl-1,3-thiazol-2-amine has a molecular weight of 204.30 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 1229694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).