C12H13N3S2 — CID 3001082
1-(2-phenylethyl)-3-(1,3-thiazol-2-yl)thiourea (PubChem CID 3001082) has the molecular formula C12H13N3S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-(1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-(2-phenylethyl)-3-(1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 3001082 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-(2-phenylethyl)-3-(1,3-thiazol-2-yl)thiourea |
| SMILES | S=C(NCCc1ccccc1)Nc1nccs1 |
| InChI | InChI=1S/C12H13N3S2/c16-11(15-12-14-8-9-17-12)13-7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H2,13,14,15,16) |
| InChIKey | ANUSGJXVCFPWMQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|