C15H16N2O4S2 — CID 123102750
2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfinyl-4-phenylbutanoic acid (PubChem CID 123102750) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfinyl-4-phenylbutanoic acid.
| Compound Name | 2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfinyl-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 123102750 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfinyl-4-phenylbutanoic acid |
| SMILES | O=C(CS(=O)C(CCc1ccccc1)C(=O)O)Nc1nccs1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-13(17-15-16-8-9-22-15)10-23(21)12(14(19)20)7-6-11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,10H2,(H,19,20)(H,16,17,18) |
| InChIKey | ZJYKUTUKHAOSBF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |