C21H11BrClFN2O4S — CID 1231135
5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 1231135) has the molecular formula C21H11BrClFN2O4S and a molecular weight of 521.75 g/mol. Its IUPAC name is 5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1231135 |
| Molecular Formula | C21H11BrClFN2O4S |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 519.93 |
| IUPAC Name | 5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(F)c2)C(=O)C1=Cc1cc(Br)c(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H11BrClFN2O4S/c22-17-10-14(30-20(17)31-15-6-4-11(23)5-7-15)9-16-18(27)25-21(29)26(19(16)28)13-3-1-2-12(24)8-13/h1-10H,(H,25,27,29) |
| InChIKey | OVQLTVXMZIFBLT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|