C21H10BrCl3N2O4S — CID 124534084
(5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124534084) has the molecular formula C21H10BrCl3N2O4S and a molecular weight of 572.65 g/mol. Its IUPAC name is (5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124534084 |
| Molecular Formula | C21H10BrCl3N2O4S |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 569.86 |
| IUPAC Name | (5E)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-(3,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C/c1cc(Br)c(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H10BrCl3N2O4S/c22-15-9-12(31-20(15)32-13-4-1-10(23)2-5-13)8-14-18(28)26-21(30)27(19(14)29)11-3-6-16(24)17(25)7-11/h1-9H,(H,26,28,30)/b14-8+ |
| InChIKey | DHOIOOXRMGCTSK-RIYZIHGNSA-N |
| XLogP | 6.82 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|