C24H18BrClN2O3S2 — CID 21214506
(5Z)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 21214506) has the molecular formula C24H18BrClN2O3S2 and a molecular weight of 561.91 g/mol. Its IUPAC name is (5Z)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 21214506 |
| Molecular Formula | C24H18BrClN2O3S2 |
| Molecular Weight | 561.91 g/mol |
| Exact Mass | 559.96 |
| IUPAC Name | (5Z)-5-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Br)c(Sc3ccc(Cl)cc3)o2)C(=O)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C24H18BrClN2O3S2/c1-2-12-27-21(29)19(22(30)28(24(27)32)16-6-4-3-5-7-16)13-17-14-20(25)23(31-17)33-18-10-8-15(26)9-11-18/h3-11,13-14H,2,12H2,1H3/b19-13- |
| InChIKey | DHPOTQMGWZXOPJ-UYRXBGFRSA-N |
| XLogP | 6.80 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|