C24H25BrN2O4S — CID 126023578
(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126023578) has the molecular formula C24H25BrN2O4S and a molecular weight of 517.45 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126023578 |
| Molecular Formula | C24H25BrN2O4S |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | (5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1C(=O)/C(=C\c2cc(Br)c(OCC)cc2OCC)C(=O)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C24H25BrN2O4S/c1-4-12-26-22(28)18(23(29)27(24(26)32)17-10-8-7-9-11-17)13-16-14-19(25)21(31-6-3)15-20(16)30-5-2/h7-11,13-15H,4-6,12H2,1-3H3/b18-13+ |
| InChIKey | CSMZMOKYKBLMHN-QGOAFFKASA-N |
| XLogP | 5.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|