C22H19BrN2O6S — CID 126195890
4-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 126195890) has the molecular formula C22H19BrN2O6S and a molecular weight of 519.37 g/mol. Its IUPAC name is 4-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 4-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126195890 |
| Molecular Formula | C22H19BrN2O6S |
| Molecular Weight | 519.37 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 4-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | CCOc1cc(OCC)c(/C=C2\C(=O)NC(=S)N(c3ccc(C(=O)O)cc3)C2=O)cc1Br |
| InChI | InChI=1S/C22H19BrN2O6S/c1-3-30-17-11-18(31-4-2)16(23)10-13(17)9-15-19(26)24-22(32)25(20(15)27)14-7-5-12(6-8-14)21(28)29/h5-11H,3-4H2,1-2H3,(H,28,29)(H,24,26,32)/b15-9+ |
| InChIKey | MFYLIKBPYYFECU-OQLLNIDSSA-N |
| XLogP | 3.78 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|