C26H26N4O2S — CID 5429488
(5Z)-5-[[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 5429488) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is (5Z)-5-[[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-5-[[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 5429488 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (5Z)-5-[[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-1-phenyl-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1C(=O)/C(=C/c2cc(C)n(-c3ccc(C)cn3)c2C)C(=O)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C26H26N4O2S/c1-5-13-28-24(31)22(25(32)30(26(28)33)21-9-7-6-8-10-21)15-20-14-18(3)29(19(20)4)23-12-11-17(2)16-27-23/h6-12,14-16H,5,13H2,1-4H3/b22-15- |
| InChIKey | ZOCSGMRVDGZJRJ-JCMHNJIXSA-N |
| XLogP | 4.75 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|