C21H26O4S — CID 123116575
2-[3-(4-methylphenoxy)propylsulfinyl]-4-(4-methylphenyl)butanoic acid (PubChem CID 123116575) has the molecular formula C21H26O4S and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-[3-(4-methylphenoxy)propylsulfinyl]-4-(4-methylphenyl)butanoic acid.
| Compound Name | 2-[3-(4-methylphenoxy)propylsulfinyl]-4-(4-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 123116575 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[3-(4-methylphenoxy)propylsulfinyl]-4-(4-methylphenyl)butanoic acid |
| SMILES | Cc1ccc(CCC(C(=O)O)S(=O)CCCOc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H26O4S/c1-16-4-8-18(9-5-16)10-13-20(21(22)23)26(24)15-3-14-25-19-11-6-17(2)7-12-19/h4-9,11-12,20H,3,10,13-15H2,1-2H3,(H,22,23) |
| InChIKey | AFWKHBRSXLTVIF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|