C10H21NO4S — CID 123117550
N-butyl-2-(2,3-dihydroxypropylsulfinyl)-N-methylacetamide (PubChem CID 123117550) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is N-butyl-2-(2,3-dihydroxypropylsulfinyl)-N-methylacetamide.
| Compound Name | N-butyl-2-(2,3-dihydroxypropylsulfinyl)-N-methylacetamide |
|---|---|
| PubChem CID | 123117550 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-butyl-2-(2,3-dihydroxypropylsulfinyl)-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)CS(=O)CC(O)CO |
| InChI | InChI=1S/C10H21NO4S/c1-3-4-5-11(2)10(14)8-16(15)7-9(13)6-12/h9,12-13H,3-8H2,1-2H3 |
| InChIKey | QNGGJUZRFBLFDC-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |