C9H18O6S — CID 123117567
2-ethoxyethyl 2-(2,3-dihydroxypropylsulfinyl)acetate (PubChem CID 123117567) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(2,3-dihydroxypropylsulfinyl)acetate.
| Compound Name | 2-ethoxyethyl 2-(2,3-dihydroxypropylsulfinyl)acetate |
|---|---|
| PubChem CID | 123117567 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-ethoxyethyl 2-(2,3-dihydroxypropylsulfinyl)acetate |
| SMILES | CCOCCOC(=O)CS(=O)CC(O)CO |
| InChI | InChI=1S/C9H18O6S/c1-2-14-3-4-15-9(12)7-16(13)6-8(11)5-10/h8,10-11H,2-7H2,1H3 |
| InChIKey | PHHNZFTZPYFXFY-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|