C25H26N4O — CID 123136927
7,11-ditert-butyl-3,6,8,10-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-16-ol (PubChem CID 123136927) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 7,11-ditert-butyl-3,6,8,10-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-16-ol.
| Compound Name | 7,11-ditert-butyl-3,6,8,10-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-16-ol |
|---|---|
| PubChem CID | 123136927 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 7,11-ditert-butyl-3,6,8,10-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-16-ol |
| SMILES | CC(C)(C)c1ncc2nc3c4cc5cccc(O)c5cc4cc(C(C)(C)C)n3c2n1 |
| InChI | InChI=1S/C25H26N4O/c1-24(2,3)20-12-15-11-16-14(8-7-9-19(16)30)10-17(15)21-27-18-13-26-23(25(4,5)6)28-22(18)29(20)21/h7-13,30H,1-6H3 |
| InChIKey | YJARZKHXCSGMBV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|