C31H62 — CID 123137231
2,3,4,22,23-pentamethyl-12-methylidenepentacosane (PubChem CID 123137231) has the molecular formula C31H62 and a molecular weight of 434.84 g/mol. Its IUPAC name is 2,3,4,22,23-pentamethyl-12-methylidenepentacosane.
| Compound Name | 2,3,4,22,23-pentamethyl-12-methylidenepentacosane |
|---|---|
| PubChem CID | 123137231 |
| Molecular Formula | C31H62 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.49 |
| IUPAC Name | 2,3,4,22,23-pentamethyl-12-methylidenepentacosane |
| SMILES | C=C(CCCCCCCCCC(C)C(C)CC)CCCCCCCC(C)C(C)C(C)C |
| InChI | InChI=1S/C31H62/c1-9-28(5)29(6)24-20-16-12-10-11-14-18-22-27(4)23-19-15-13-17-21-25-30(7)31(8)26(2)3/h26,28-31H,4,9-25H2,1-3,5-8H3 |
| InChIKey | FGUJVHYGHBBSGQ-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|