C11H13N — CID 123137253
6-cyclohexa-1,3-dien-1-yl-3,4-dihydropyridine (PubChem CID 123137253) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 6-cyclohexa-1,3-dien-1-yl-3,4-dihydropyridine.
| Compound Name | 6-cyclohexa-1,3-dien-1-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123137253 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 6-cyclohexa-1,3-dien-1-yl-3,4-dihydropyridine |
| SMILES | C1=CCCC(C2=CCCC=N2)=C1 |
| InChI | InChI=1S/C11H13N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-2,6,8-9H,3-5,7H2 |
| InChIKey | WZYVZZRIZFVXKD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |