C22H21N3O3 — CID 123137704
5-hydroxy-N-methyl-4-oxo-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)pyridazine-3-carboxamide (PubChem CID 123137704) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 5-hydroxy-N-methyl-4-oxo-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)pyridazine-3-carboxamide.
| Compound Name | 5-hydroxy-N-methyl-4-oxo-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 123137704 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-hydroxy-N-methyl-4-oxo-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)pyridazine-3-carboxamide |
| SMILES | CNC(=O)c1nn(CC2c3ccccc3CCc3ccccc32)cc(O)c1=O |
| InChI | InChI=1S/C22H21N3O3/c1-23-22(28)20-21(27)19(26)13-25(24-20)12-18-16-8-4-2-6-14(16)10-11-15-7-3-5-9-17(15)18/h2-9,13,18,26H,10-12H2,1H3,(H,23,28) |
| InChIKey | PMSPQCDDFJNLKG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |