C33H32F3N2O7P — CID 123138817
dibenzyl [2-[(2,2-difluoroacetyl)amino]-3-fluoro-1-[4-[6-(3-hydroxyoxetan-3-yl)-3-pyridinyl]phenyl]propyl] phosphate (PubChem CID 123138817) has the molecular formula C33H32F3N2O7P and a molecular weight of 656.59 g/mol. Its IUPAC name is dibenzyl [2-[(2,2-difluoroacetyl)amino]-3-fluoro-1-[4-[6-(3-hydroxyoxetan-3-yl)-3-pyridinyl]phenyl]propyl] phosphate.
| Compound Name | dibenzyl [2-[(2,2-difluoroacetyl)amino]-3-fluoro-1-[4-[6-(3-hydroxyoxetan-3-yl)-3-pyridinyl]phenyl]propyl] phosphate |
|---|---|
| PubChem CID | 123138817 |
| Molecular Formula | C33H32F3N2O7P |
| Molecular Weight | 656.59 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | dibenzyl [2-[(2,2-difluoroacetyl)amino]-3-fluoro-1-[4-[6-(3-hydroxyoxetan-3-yl)-3-pyridinyl]phenyl]propyl] phosphate |
| SMILES | O=C(NC(CF)C(OP(=O)(OCc1ccccc1)OCc1ccccc1)c1ccc(-c2ccc(C3(O)COC3)nc2)cc1)C(F)F |
| InChI | InChI=1S/C33H32F3N2O7P/c34-17-28(38-32(39)31(35)36)30(26-13-11-25(12-14-26)27-15-16-29(37-18-27)33(40)21-42-22-33)45-46(41,43-19-23-7-3-1-4-8-23)44-20-24-9-5-2-6-10-24/h1-16,18,28,30-31,40H,17,19-22H2,(H,38,39) |
| InChIKey | SJJODRIBAIIAHZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|