C20H19FN4 — CID 123139933
4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-2-(methylamino)benzenecarboximidamide (PubChem CID 123139933) has the molecular formula C20H19FN4 and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-2-(methylamino)benzenecarboximidamide.
| Compound Name | 4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-2-(methylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 123139933 |
| Molecular Formula | C20H19FN4 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-2-(methylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cccnc2-c2ccc(F)c(C)c2)cc1NC |
| InChI | InChI=1S/C20H19FN4/c1-12-10-14(6-8-17(12)21)19-15(4-3-9-25-19)13-5-7-16(20(22)23)18(11-13)24-2/h3-11,24H,1-2H3,(H3,22,23) |
| InChIKey | WYCRVRJBAIWNKJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|