C20H20FN3 — CID 167216812
1-N-ethyl-4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzene-1,2-diamine (PubChem CID 167216812) has the molecular formula C20H20FN3 and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-N-ethyl-4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzene-1,2-diamine.
| Compound Name | 1-N-ethyl-4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 167216812 |
| Molecular Formula | C20H20FN3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-N-ethyl-4-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzene-1,2-diamine |
| SMILES | CCNc1ccc(-c2cccnc2-c2ccc(F)c(C)c2)cc1N |
| InChI | InChI=1S/C20H20FN3/c1-3-23-19-9-7-14(12-18(19)22)16-5-4-10-24-20(16)15-6-8-17(21)13(2)11-15/h4-12,23H,3,22H2,1-2H3 |
| InChIKey | LKDWSVNFVNLZPU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|