C23H20FN3 — CID 123470033
7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-2-amine (PubChem CID 123470033) has the molecular formula C23H20FN3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-2-amine.
| Compound Name | 7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-2-amine |
|---|---|
| PubChem CID | 123470033 |
| Molecular Formula | C23H20FN3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-2-amine |
| SMILES | Cc1cc(-c2ncccc2-c2ccc3c(c2)C=CC(C)C(N)=N3)ccc1F |
| InChI | InChI=1S/C23H20FN3/c1-14-5-6-17-13-16(8-10-21(17)27-23(14)25)19-4-3-11-26-22(19)18-7-9-20(24)15(2)12-18/h3-14H,1-2H3,(H2,25,27) |
| InChIKey | UBMWOWKSSIIYBG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |