About CID 123140210
CID 123140210 (PubChem CID 123140210) has the molecular formula C26H29N5O
and a molecular weight of 427.55 g/mol.
Molecular Properties
| Compound Name | CID 123140210 |
| PubChem CID | 123140210 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | — |
| SMILES | CC1CC(C)CC2(Cc3ccc(C#N)cc3C23N=C(N)N(CCc2ccncc2)C3=O)C1 |
| InChI | InChI=1S/C26H29N5O/c1-17-11-18(2)14-25(13-17)15-21-4-3-20(16-27)12-22(21)26(25)23(32)31(24(28)30-26)10-7-19-5-8-29-9-6-19/h3-6,8-9,12,17-18H,7,10-11,13-15H2,1-2H3,(H2,28,30) |
| InChIKey | JVLPZLXTYNNKBA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 123140210 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123140210?
The IUPAC name of CID 123140210 (CID 123140210) is not available.
What is the SMILES notation for CID 123140210?
The canonical SMILES for CID 123140210 is CC1CC(C)CC2(Cc3ccc(C#N)cc3C23N=C(N)N(CCc2ccncc2)C3=O)C1.
What is the InChIKey of CID 123140210?
The InChIKey is JVLPZLXTYNNKBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N5O/c1-17-11-18(2)14-25(13-17)15-21-4-3-20(16-27)12-22(21)26(25)23(32)31(24(28)30-26)10-7-19-5-8-29-9-6-19/h3-6,8-9,12,17-18H,7,10-11,13-15H2,1-2H3,(H2,28,30).
What are the key properties of CID 123140210?
CID 123140210 has a molecular weight of 427.55 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123140210 is sourced from PubChem (CID 123140210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).