C28H35F2N3O — CID 123508205
CID 123508205 (PubChem CID 123508205) has the molecular formula C28H35F2N3O and a molecular weight of 467.60 g/mol.
| Compound Name | CID 123508205 |
|---|---|
| PubChem CID | 123508205 |
| Molecular Formula | C28H35F2N3O |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | — |
| SMILES | [H]/N=C1\CC(CC)C2(C(=O)N1CC1CC(F)(F)C1)c1cc(C#N)ccc1CC21CC(C)CC(C)C1 |
| InChI | InChI=1S/C28H35F2N3O/c1-4-22-9-24(32)33(16-20-12-27(29,30)13-20)25(34)28(22)23-8-19(15-31)5-6-21(23)14-26(28)10-17(2)7-18(3)11-26/h5-6,8,17-18,20,22,32H,4,7,9-14,16H2,1-3H3/b32-24+ |
| InChIKey | HHYFOUYLCCOXQB-FEZSWGLMSA-N |
| XLogP | 6.08 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|