C14H13FN2O2 — CID 79507329
4-fluoro-3-[(4-methyl-2,6-dioxopiperidin-1-yl)methyl]benzonitrile (PubChem CID 79507329) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 4-fluoro-3-[(4-methyl-2,6-dioxopiperidin-1-yl)methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[(4-methyl-2,6-dioxopiperidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 79507329 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-fluoro-3-[(4-methyl-2,6-dioxopiperidin-1-yl)methyl]benzonitrile |
| SMILES | CC1CC(=O)N(Cc2cc(C#N)ccc2F)C(=O)C1 |
| InChI | InChI=1S/C14H13FN2O2/c1-9-4-13(18)17(14(19)5-9)8-11-6-10(7-16)2-3-12(11)15/h2-3,6,9H,4-5,8H2,1H3 |
| InChIKey | DOUZZIWMCIXUFK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|