C11H15NS — CID 123141058
2-(2,4-dimethylanilino)propanethial (PubChem CID 123141058) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)propanethial.
| Compound Name | 2-(2,4-dimethylanilino)propanethial |
|---|---|
| PubChem CID | 123141058 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(2,4-dimethylanilino)propanethial |
| SMILES | Cc1ccc(NC(C)C=S)c(C)c1 |
| InChI | InChI=1S/C11H15NS/c1-8-4-5-11(9(2)6-8)12-10(3)7-13/h4-7,10,12H,1-3H3 |
| InChIKey | VUPDBPFPQNCPHU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|