C23H31N5O — CID 123141239
4-[2-[(4-methanimidoylcyclohexyl)amino]-4-pyridinyl]-N-(oxan-4-ylmethyl)pyridin-2-amine (PubChem CID 123141239) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-[2-[(4-methanimidoylcyclohexyl)amino]-4-pyridinyl]-N-(oxan-4-ylmethyl)pyridin-2-amine.
| Compound Name | 4-[2-[(4-methanimidoylcyclohexyl)amino]-4-pyridinyl]-N-(oxan-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 123141239 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 4-[2-[(4-methanimidoylcyclohexyl)amino]-4-pyridinyl]-N-(oxan-4-ylmethyl)pyridin-2-amine |
| SMILES | [H]/N=C/C1CCC(Nc2cc(-c3ccnc(NCC4CCOCC4)c3)ccn2)CC1 |
| InChI | InChI=1S/C23H31N5O/c24-15-17-1-3-21(4-2-17)28-23-14-20(6-10-26-23)19-5-9-25-22(13-19)27-16-18-7-11-29-12-8-18/h5-6,9-10,13-15,17-18,21,24H,1-4,7-8,11-12,16H2,(H,25,27)(H,26,28)/b24-15+ |
| InChIKey | FISPZESSXKITIM-BUVRLJJBSA-N |
| XLogP | 4.60 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|