C13H33N3Si — CID 123141475
N-butylsilyl-N',N',N",N"-tetraethylmethanetriamine (PubChem CID 123141475) has the molecular formula C13H33N3Si and a molecular weight of 259.51 g/mol. Its IUPAC name is N-butylsilyl-N',N',N",N"-tetraethylmethanetriamine.
| Compound Name | N-butylsilyl-N',N',N",N"-tetraethylmethanetriamine |
|---|---|
| PubChem CID | 123141475 |
| Molecular Formula | C13H33N3Si |
| Molecular Weight | 259.51 g/mol |
| Exact Mass | 259.24 |
| IUPAC Name | N-butylsilyl-N',N',N",N"-tetraethylmethanetriamine |
| SMILES | CCCC[SiH2]NC(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C13H33N3Si/c1-6-11-12-17-14-13(15(7-2)8-3)16(9-4)10-5/h13-14H,6-12,17H2,1-5H3 |
| InChIKey | CMHDUFSOGUNCMT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|