C12H28ClNSi — CID 123214615
4-butylsilyl-1-chloro-N,N-diethylbutan-1-amine (PubChem CID 123214615) has the molecular formula C12H28ClNSi and a molecular weight of 249.90 g/mol. Its IUPAC name is 4-butylsilyl-1-chloro-N,N-diethylbutan-1-amine.
| Compound Name | 4-butylsilyl-1-chloro-N,N-diethylbutan-1-amine |
|---|---|
| PubChem CID | 123214615 |
| Molecular Formula | C12H28ClNSi |
| Molecular Weight | 249.90 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-butylsilyl-1-chloro-N,N-diethylbutan-1-amine |
| SMILES | CCCC[SiH2]CCCC(Cl)N(CC)CC |
| InChI | InChI=1S/C12H28ClNSi/c1-4-7-10-15-11-8-9-12(13)14(5-2)6-3/h12H,4-11,15H2,1-3H3 |
| InChIKey | CNESZUHXZKNRSC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|