C22H26FN5O2S — CID 123141632
N-[3-[3-[(1-amino-2,2-dimethylpropylidene)amino]-4-methyloxolan-3-yl]-4-fluorophenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 123141632) has the molecular formula C22H26FN5O2S and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[3-[3-[(1-amino-2,2-dimethylpropylidene)amino]-4-methyloxolan-3-yl]-4-fluorophenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-[3-[3-[(1-amino-2,2-dimethylpropylidene)amino]-4-methyloxolan-3-yl]-4-fluorophenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 123141632 |
| Molecular Formula | C22H26FN5O2S |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[3-[3-[(1-amino-2,2-dimethylpropylidene)amino]-4-methyloxolan-3-yl]-4-fluorophenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | CC1COCC1(/N=C(\N)C(C)(C)C)c1cc(NC(=O)c2cn3ccsc3n2)ccc1F |
| InChI | InChI=1S/C22H26FN5O2S/c1-13-11-30-12-22(13,27-19(24)21(2,3)4)15-9-14(5-6-16(15)23)25-18(29)17-10-28-7-8-31-20(28)26-17/h5-10,13H,11-12H2,1-4H3,(H2,24,27)(H,25,29) |
| InChIKey | ZHIVAWNCCCUSNQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|