C13H10ClN3O6 — CID 123142443
dimethyl 2-(5-chloro-2-nitrophenyl)-1H-imidazole-4,5-dicarboxylate (PubChem CID 123142443) has the molecular formula C13H10ClN3O6 and a molecular weight of 339.69 g/mol. Its IUPAC name is dimethyl 2-(5-chloro-2-nitrophenyl)-1H-imidazole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5-chloro-2-nitrophenyl)-1H-imidazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 123142443 |
| Molecular Formula | C13H10ClN3O6 |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | dimethyl 2-(5-chloro-2-nitrophenyl)-1H-imidazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nc(-c2cc(Cl)ccc2[N+](=O)[O-])[nH]c1C(=O)OC |
| InChI | InChI=1S/C13H10ClN3O6/c1-22-12(18)9-10(13(19)23-2)16-11(15-9)7-5-6(14)3-4-8(7)17(20)21/h3-5H,1-2H3,(H,15,16) |
| InChIKey | OJUDVKJNIUVTMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|