C10H5ClN2O5 — CID 150693049
4-(5-chloro-2-nitrophenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 150693049) has the molecular formula C10H5ClN2O5 and a molecular weight of 268.61 g/mol. Its IUPAC name is 4-(5-chloro-2-nitrophenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 4-(5-chloro-2-nitrophenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 150693049 |
| Molecular Formula | C10H5ClN2O5 |
| Molecular Weight | 268.61 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 4-(5-chloro-2-nitrophenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1nocc1-c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H5ClN2O5/c11-5-1-2-8(13(16)17)6(3-5)7-4-18-12-9(7)10(14)15/h1-4H,(H,14,15) |
| InChIKey | JKGZUNZBORZSCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|