C25H28N4O2 — CID 123143625
N-[7-[5-[N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidoyl]-2-methylphenyl]isoquinolin-3-yl]cyclopropanecarboxamide (PubChem CID 123143625) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[7-[5-[N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidoyl]-2-methylphenyl]isoquinolin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[7-[5-[N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidoyl]-2-methylphenyl]isoquinolin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 123143625 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[7-[5-[N'-(1-hydroxy-2-methylpropan-2-yl)carbamimidoyl]-2-methylphenyl]isoquinolin-3-yl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(/C(N)=N/C(C)(C)CO)cc1-c1ccc2cc(NC(=O)C3CC3)ncc2c1 |
| InChI | InChI=1S/C25H28N4O2/c1-15-4-5-19(23(26)29-25(2,3)14-30)11-21(15)18-9-8-17-12-22(27-13-20(17)10-18)28-24(31)16-6-7-16/h4-5,8-13,16,30H,6-7,14H2,1-3H3,(H2,26,29)(H,27,28,31) |
| InChIKey | HIEPGTKHSGVROF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|