C31H35N3O — CID 129170363
N-[7-[2-methyl-5-[1-[(1-pent-1-en-2-ylcyclobutyl)amino]ethenyl]phenyl]isoquinolin-3-yl]cyclopropanecarboxamide (PubChem CID 129170363) has the molecular formula C31H35N3O and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[7-[2-methyl-5-[1-[(1-pent-1-en-2-ylcyclobutyl)amino]ethenyl]phenyl]isoquinolin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[7-[2-methyl-5-[1-[(1-pent-1-en-2-ylcyclobutyl)amino]ethenyl]phenyl]isoquinolin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 129170363 |
| Molecular Formula | C31H35N3O |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-[7-[2-methyl-5-[1-[(1-pent-1-en-2-ylcyclobutyl)amino]ethenyl]phenyl]isoquinolin-3-yl]cyclopropanecarboxamide |
| SMILES | C=C(NC1(C(=C)CCC)CCC1)c1ccc(C)c(-c2ccc3cc(NC(=O)C4CC4)ncc3c2)c1 |
| InChI | InChI=1S/C31H35N3O/c1-5-7-21(3)31(14-6-15-31)34-22(4)24-9-8-20(2)28(17-24)26-13-12-25-18-29(32-19-27(25)16-26)33-30(35)23-10-11-23/h8-9,12-13,16-19,23,34H,3-7,10-11,14-15H2,1-2H3,(H,32,33,35) |
| InChIKey | WDYJCRPNIIGZDR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|