C9H16N2O2S2 — CID 123145428
N-(1,3-thiazol-2-yl)hexane-3-sulfonamide (PubChem CID 123145428) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)hexane-3-sulfonamide.
| Compound Name | N-(1,3-thiazol-2-yl)hexane-3-sulfonamide |
|---|---|
| PubChem CID | 123145428 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-(1,3-thiazol-2-yl)hexane-3-sulfonamide |
| SMILES | CCCC(CC)S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-3-5-8(4-2)15(12,13)11-9-10-6-7-14-9/h6-8H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | HAUSOZWQGMZUGR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |