C9H10ClFN2O2S2 — CID 123940985
5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)hexa-2,4-diene-3-sulfonamide (PubChem CID 123940985) has the molecular formula C9H10ClFN2O2S2 and a molecular weight of 296.78 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)hexa-2,4-diene-3-sulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)hexa-2,4-diene-3-sulfonamide |
|---|---|
| PubChem CID | 123940985 |
| Molecular Formula | C9H10ClFN2O2S2 |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)hexa-2,4-diene-3-sulfonamide |
| SMILES | CC(Cl)=CC(=C(C)F)S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H10ClFN2O2S2/c1-6(10)5-8(7(2)11)17(14,15)13-9-12-3-4-16-9/h3-5H,1-2H3,(H,12,13) |
| InChIKey | YKGRAKOBODRNKZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|