C7H8N2O2S2 — CID 123778595
N-(1,3-thiazol-2-yl)buta-1,3-diene-2-sulfonamide (PubChem CID 123778595) has the molecular formula C7H8N2O2S2 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)buta-1,3-diene-2-sulfonamide.
| Compound Name | N-(1,3-thiazol-2-yl)buta-1,3-diene-2-sulfonamide |
|---|---|
| PubChem CID | 123778595 |
| Molecular Formula | C7H8N2O2S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | N-(1,3-thiazol-2-yl)buta-1,3-diene-2-sulfonamide |
| SMILES | C=CC(=C)S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H8N2O2S2/c1-3-6(2)13(10,11)9-7-8-4-5-12-7/h3-5H,1-2H2,(H,8,9) |
| InChIKey | PPCWNXFNWWUDSZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|