C8H10N2O2S2 — CID 91340327
N-(1,3-thiazol-2-yl)penta-1,3-diene-3-sulfonamide (PubChem CID 91340327) has the molecular formula C8H10N2O2S2 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)penta-1,3-diene-3-sulfonamide.
| Compound Name | N-(1,3-thiazol-2-yl)penta-1,3-diene-3-sulfonamide |
|---|---|
| PubChem CID | 91340327 |
| Molecular Formula | C8H10N2O2S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | N-(1,3-thiazol-2-yl)penta-1,3-diene-3-sulfonamide |
| SMILES | C=CC(=CC)S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H10N2O2S2/c1-3-7(4-2)14(11,12)10-8-9-5-6-13-8/h3-6H,1H2,2H3,(H,9,10) |
| InChIKey | IEVNRNZHQNCHKX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|