C18H19NO5S2 — CID 123150272
methyl 2-[(4-methylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate (PubChem CID 123150272) has the molecular formula C18H19NO5S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate.
| Compound Name | methyl 2-[(4-methylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 123150272 |
| Molecular Formula | C18H19NO5S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | methyl 2-[(4-methylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate |
| SMILES | COC(=O)C(=NOS(=O)(=O)Cc1ccc(C)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO5S2/c1-13-4-8-15(9-5-13)12-26(21,22)24-19-17(18(20)23-3)25-16-10-6-14(2)7-11-16/h4-11H,12H2,1-3H3 |
| InChIKey | AUORQSRHSAEHKR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|