C19H17NO5S2 — CID 123436601
methyl 2-[(4-ethynylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate (PubChem CID 123436601) has the molecular formula C19H17NO5S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 2-[(4-ethynylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate.
| Compound Name | methyl 2-[(4-ethynylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 123436601 |
| Molecular Formula | C19H17NO5S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | methyl 2-[(4-ethynylphenyl)methylsulfonyloxyimino]-2-(4-methylphenyl)sulfanylacetate |
| SMILES | C#Cc1ccc(CS(=O)(=O)ON=C(Sc2ccc(C)cc2)C(=O)OC)cc1 |
| InChI | InChI=1S/C19H17NO5S2/c1-4-15-7-9-16(10-8-15)13-27(22,23)25-20-18(19(21)24-3)26-17-11-5-14(2)6-12-17/h1,5-12H,13H2,2-3H3 |
| InChIKey | XKLQVDIKTWIICN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|