C20H22N7O2S- — CID 123150777
4-(cyanomethyl)-1-[2-[[4-(2-sulfinatohydrazinyl)cyclohexyl]amino]pyrimidin-4-yl]indole (PubChem CID 123150777) has the molecular formula C20H22N7O2S- and a molecular weight of 424.51 g/mol. Its IUPAC name is 4-(cyanomethyl)-1-[2-[[4-(2-sulfinatohydrazinyl)cyclohexyl]amino]pyrimidin-4-yl]indole.
| Compound Name | 4-(cyanomethyl)-1-[2-[[4-(2-sulfinatohydrazinyl)cyclohexyl]amino]pyrimidin-4-yl]indole |
|---|---|
| PubChem CID | 123150777 |
| Molecular Formula | C20H22N7O2S- |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-(cyanomethyl)-1-[2-[[4-(2-sulfinatohydrazinyl)cyclohexyl]amino]pyrimidin-4-yl]indole |
| SMILES | N#CCc1cccc2c1ccn2-c1ccnc(NC2CCC(NNS(=O)[O-])CC2)n1 |
| InChI | InChI=1S/C20H23N7O2S/c21-11-8-14-2-1-3-18-17(14)10-13-27(18)19-9-12-22-20(24-19)23-15-4-6-16(7-5-15)25-26-30(28)29/h1-3,9-10,12-13,15-16,25-26H,4-8H2,(H,28,29)(H,22,23,24)/p-1 |
| InChIKey | TZQXVQZVJQXAEN-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|