C20H25N5O3S — CID 59743348
N-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indol-4-yl]-N-methylmethanesulfonamide (PubChem CID 59743348) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indol-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indol-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 59743348 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indol-4-yl]-N-methylmethanesulfonamide |
| SMILES | CN(c1cccc2c1ccn2-c1ccnc(NC2CCC(O)CC2)n1)S(C)(=O)=O |
| InChI | InChI=1S/C20H25N5O3S/c1-24(29(2,27)28)17-4-3-5-18-16(17)11-13-25(18)19-10-12-21-20(23-19)22-14-6-8-15(26)9-7-14/h3-5,10-15,26H,6-9H2,1-2H3,(H,21,22,23) |
| InChIKey | IMFQDJXKOGWVNK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |