C24H31N5O4S — CID 59743420
N-[4-[[4-[4-(2-methylsulfonylethoxymethyl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]acetamide (PubChem CID 59743420) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[4-[[4-[4-(2-methylsulfonylethoxymethyl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[4-[4-(2-methylsulfonylethoxymethyl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 59743420 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[4-[[4-[4-(2-methylsulfonylethoxymethyl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Nc2nccc(-n3ccc4c(COCCS(C)(=O)=O)cccc43)n2)CC1 |
| InChI | InChI=1S/C24H31N5O4S/c1-17(30)26-19-6-8-20(9-7-19)27-24-25-12-10-23(28-24)29-13-11-21-18(4-3-5-22(21)29)16-33-14-15-34(2,31)32/h3-5,10-13,19-20H,6-9,14-16H2,1-2H3,(H,26,30)(H,25,27,28) |
| InChIKey | RWFNVGDDNCNBSG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|