C22H26F2N4O3S — CID 59743431
N-(4,4-difluorocyclohexyl)-4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-amine (PubChem CID 59743431) has the molecular formula C22H26F2N4O3S and a molecular weight of 464.54 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-amine.
| Compound Name | N-(4,4-difluorocyclohexyl)-4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59743431 |
| Molecular Formula | C22H26F2N4O3S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1ccn2-c1ccnc(NC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C22H26F2N4O3S/c1-32(29,30)15-3-14-31-19-5-2-4-18-17(19)9-13-28(18)20-8-12-25-21(27-20)26-16-6-10-22(23,24)11-7-16/h2,4-5,8-9,12-13,16H,3,6-7,10-11,14-15H2,1H3,(H,25,26,27) |
| InChIKey | UZENBERTRXFJHA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|