C23H29N5O3 — CID 91362323
tert-butyl 4-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 91362323) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91362323 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | tert-butyl 4-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | COc1cccc2c1ccn2-c1ccnc(NC2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C23H29N5O3/c1-23(2,3)31-22(29)27-13-9-16(10-14-27)25-21-24-12-8-20(26-21)28-15-11-17-18(28)6-5-7-19(17)30-4/h5-8,11-12,15-16H,9-10,13-14H2,1-4H3,(H,24,25,26) |
| InChIKey | XUTZHTGWDLBKDL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |