C28H35F2N5O4S — CID 59743368
(4,4-difluoropiperidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone (PubChem CID 59743368) has the molecular formula C28H35F2N5O4S and a molecular weight of 575.68 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 59743368 |
| Molecular Formula | C28H35F2N5O4S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1ccn2-c1ccnc(NC2CCC(C(=O)N3CCC(F)(F)CC3)CC2)n1 |
| InChI | InChI=1S/C28H35F2N5O4S/c1-40(37,38)19-3-18-39-24-5-2-4-23-22(24)11-15-35(23)25-10-14-31-27(33-25)32-21-8-6-20(7-9-21)26(36)34-16-12-28(29,30)13-17-34/h2,4-5,10-11,14-15,20-21H,3,6-9,12-13,16-19H2,1H3,(H,31,32,33) |
| InChIKey | JQCBHTULSVVPFD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|