C28H37N5O4S — CID 123753036
[4-[[4-(3-methylsulfonylpropoxy)indol-1-yl]-pyrimidin-2-ylamino]cyclohexyl]-piperidin-1-ylmethanone (PubChem CID 123753036) has the molecular formula C28H37N5O4S and a molecular weight of 539.70 g/mol. Its IUPAC name is [4-[[4-(3-methylsulfonylpropoxy)indol-1-yl]-pyrimidin-2-ylamino]cyclohexyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[[4-(3-methylsulfonylpropoxy)indol-1-yl]-pyrimidin-2-ylamino]cyclohexyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 123753036 |
| Molecular Formula | C28H37N5O4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | [4-[[4-(3-methylsulfonylpropoxy)indol-1-yl]-pyrimidin-2-ylamino]cyclohexyl]-piperidin-1-ylmethanone |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1ccn2N(c1ncccn1)C1CCC(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C28H37N5O4S/c1-38(35,36)21-7-20-37-26-9-5-8-25-24(26)14-19-32(25)33(28-29-15-6-16-30-28)23-12-10-22(11-13-23)27(34)31-17-3-2-4-18-31/h5-6,8-9,14-16,19,22-23H,2-4,7,10-13,17-18,20-21H2,1H3 |
| InChIKey | LPNSANLCLLMHOH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|